C21H17N2O6- — CID 54724959
3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]naphthalen-2-olate (PubChem CID 54724959) has the molecular formula C21H17N2O6- and a molecular weight of 393.38 g/mol. Its IUPAC name is 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]naphthalen-2-olate.
| Compound Name | 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 54724959 |
| Molecular Formula | C21H17N2O6- |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]naphthalen-2-olate |
| SMILES | COc1ccc(/C=N\NC(=O)c2cc3ccccc3cc2[O-])c(C(=O)O)c1OC |
| InChI | InChI=1S/C21H18N2O6/c1-28-17-8-7-14(18(21(26)27)19(17)29-2)11-22-23-20(25)15-9-12-5-3-4-6-13(12)10-16(15)24/h3-11,24H,1-2H3,(H,23,25)(H,26,27)/p-1/b22-11- |
| InChIKey | MRVIRCIFBOSBAD-JJFYIABZSA-M |
| XLogP | 2.39 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|