C15H13F3N4O5 — CID 51856953
2,3-dimethoxy-6-[(Z)-[[5-(trifluoromethyl)-1H-pyrazole-3-carbonyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 51856953) has the molecular formula C15H13F3N4O5 and a molecular weight of 386.29 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[[5-(trifluoromethyl)-1H-pyrazole-3-carbonyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[[5-(trifluoromethyl)-1H-pyrazole-3-carbonyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 51856953 |
| Molecular Formula | C15H13F3N4O5 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[[5-(trifluoromethyl)-1H-pyrazole-3-carbonyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(/C=N\NC(=O)c2cc(C(F)(F)F)[nH]n2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C15H13F3N4O5/c1-26-9-4-3-7(11(14(24)25)12(9)27-2)6-19-22-13(23)8-5-10(21-20-8)15(16,17)18/h3-6H,1-2H3,(H,20,21)(H,22,23)(H,24,25)/b19-6- |
| InChIKey | HKRBPELGDOJWMH-SWNXQHNESA-N |
| XLogP | 1.91 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|