C24H20FN3O6 — CID 86809619
6-[(E)-[[4-[(4-fluorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 86809619) has the molecular formula C24H20FN3O6 and a molecular weight of 465.44 g/mol. Its IUPAC name is 6-[(E)-[[4-[(4-fluorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[[4-[(4-fluorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 86809619 |
| Molecular Formula | C24H20FN3O6 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 6-[(E)-[[4-[(4-fluorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc(NC(=O)c3ccc(F)cc3)cc2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C24H20FN3O6/c1-33-19-12-7-16(20(24(31)32)21(19)34-2)13-26-28-23(30)15-5-10-18(11-6-15)27-22(29)14-3-8-17(25)9-4-14/h3-13H,1-2H3,(H,27,29)(H,28,30)(H,31,32)/b26-13+ |
| InChIKey | ADRBBURFZACXFQ-LGJNPRDNSA-N |
| XLogP | 3.56 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|