C17H14ClN2O5- — CID 4519390
6-[[(4-chlorobenzoyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate (PubChem CID 4519390) has the molecular formula C17H14ClN2O5- and a molecular weight of 361.76 g/mol. Its IUPAC name is 6-[[(4-chlorobenzoyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate.
| Compound Name | 6-[[(4-chlorobenzoyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 4519390 |
| Molecular Formula | C17H14ClN2O5- |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 6-[[(4-chlorobenzoyl)hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
| SMILES | COc1ccc(C=NNC(=O)c2ccc(Cl)cc2)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C17H15ClN2O5/c1-24-13-8-5-11(14(17(22)23)15(13)25-2)9-19-20-16(21)10-3-6-12(18)7-4-10/h3-9H,1-2H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | YBKSJLADYXHXJS-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|