C20H22N3O4S- — CID 8979058
2,3-dimethoxy-6-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]benzoate (PubChem CID 8979058) has the molecular formula C20H22N3O4S- and a molecular weight of 400.48 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8979058 |
| Molecular Formula | C20H22N3O4S- |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=N\NC(=S)Nc2ccc(C(C)C)cc2)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C20H23N3O4S/c1-12(2)13-5-8-15(9-6-13)22-20(28)23-21-11-14-7-10-16(26-3)18(27-4)17(14)19(24)25/h5-12H,1-4H3,(H,24,25)(H2,22,23,28)/p-1/b21-11- |
| InChIKey | YAUHAVMWPZPUQG-NHDPSOOVSA-M |
| XLogP | 2.51 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|