C18H16ClN2O6- — CID 8979033
6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate (PubChem CID 8979033) has the molecular formula C18H16ClN2O6- and a molecular weight of 391.79 g/mol. Its IUPAC name is 6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate.
| Compound Name | 6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 8979033 |
| Molecular Formula | C18H16ClN2O6- |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
| SMILES | COc1ccc(/C=N\NC(=O)COc2ccccc2Cl)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C18H17ClN2O6/c1-25-14-8-7-11(16(18(23)24)17(14)26-2)9-20-21-15(22)10-27-13-6-4-3-5-12(13)19/h3-9H,10H2,1-2H3,(H,21,22)(H,23,24)/p-1/b20-9- |
| InChIKey | QLCSLZYSLADEQJ-UKWGHVSLSA-M |
| XLogP | 1.25 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|