C14H18N3O5S- — CID 8978984
2,3-dimethoxy-6-[(Z)-(2-methoxyethylcarbamothioylhydrazinylidene)methyl]benzoate (PubChem CID 8978984) has the molecular formula C14H18N3O5S- and a molecular weight of 340.38 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-(2-methoxyethylcarbamothioylhydrazinylidene)methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-(2-methoxyethylcarbamothioylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 8978984 |
| Molecular Formula | C14H18N3O5S- |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-(2-methoxyethylcarbamothioylhydrazinylidene)methyl]benzoate |
| SMILES | COCCNC(=S)N/N=C\c1ccc(OC)c(OC)c1C(=O)[O-] |
| InChI | InChI=1S/C14H19N3O5S/c1-20-7-6-15-14(23)17-16-8-9-4-5-10(21-2)12(22-3)11(9)13(18)19/h4-5,8H,6-7H2,1-3H3,(H,18,19)(H2,15,17,23)/p-1/b16-8- |
| InChIKey | YEXYAUJIVGYFQC-PXNMLYILSA-M |
| XLogP | -0.49 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|