C16H20N3O5S- — CID 8979284
2,3-dimethoxy-6-[(Z)-[[(2S)-oxolan-2-yl]methylcarbamothioylhydrazinylidene]methyl]benzoate (PubChem CID 8979284) has the molecular formula C16H20N3O5S- and a molecular weight of 366.42 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[[(2S)-oxolan-2-yl]methylcarbamothioylhydrazinylidene]methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[[(2S)-oxolan-2-yl]methylcarbamothioylhydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8979284 |
| Molecular Formula | C16H20N3O5S- |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[[(2S)-oxolan-2-yl]methylcarbamothioylhydrazinylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=N\NC(=S)NC[C@@H]2CCCO2)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C16H21N3O5S/c1-22-12-6-5-10(13(15(20)21)14(12)23-2)8-18-19-16(25)17-9-11-4-3-7-24-11/h5-6,8,11H,3-4,7,9H2,1-2H3,(H,20,21)(H2,17,19,25)/p-1/b18-8-/t11-/m0/s1 |
| InChIKey | KQQQQMNXFAFKSR-LJZVVVFJSA-M |
| XLogP | 0.04 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|