C20H21N2O5S- — CID 8981850
2,3-dimethoxy-6-[(Z)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylhydrazinylidene)methyl]benzoate (PubChem CID 8981850) has the molecular formula C20H21N2O5S- and a molecular weight of 401.46 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylhydrazinylidene)methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 8981850 |
| Molecular Formula | C20H21N2O5S- |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylhydrazinylidene)methyl]benzoate |
| SMILES | COc1ccc(/C=N\NC(=O)c2cc3c(s2)CCCCC3)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C20H22N2O5S/c1-26-14-9-8-13(17(20(24)25)18(14)27-2)11-21-22-19(23)16-10-12-6-4-3-5-7-15(12)28-16/h8-11H,3-7H2,1-2H3,(H,22,23)(H,24,25)/p-1/b21-11- |
| InChIKey | ZWBPFUAIRRWLSF-NHDPSOOVSA-M |
| XLogP | 2.16 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|