C16H15N3O3S — CID 2663634
N-[(2-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 2663634) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2663634 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[(2-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1[N+](=O)[O-])c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C16H15N3O3S/c20-16(15-9-11-5-2-4-8-14(11)23-15)18-17-10-12-6-1-3-7-13(12)19(21)22/h1,3,6-7,9-10H,2,4-5,8H2,(H,18,20) |
| InChIKey | GLTYZWCKYWTTRB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|