C16H16N2OS — CID 9462599
N-[(Z)-(3-methylphenyl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (PubChem CID 9462599) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[(Z)-(3-methylphenyl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(3-methylphenyl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9462599 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[(Z)-(3-methylphenyl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| SMILES | Cc1cccc(/C=N\NC(=O)c2cc3c(s2)CCC3)c1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-4-2-5-12(8-11)10-17-18-16(19)15-9-13-6-3-7-14(13)20-15/h2,4-5,8-10H,3,6-7H2,1H3,(H,18,19)/b17-10- |
| InChIKey | UDWPPXPHDUENSP-YVLHZVERSA-N |
| XLogP | 3.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|