C16H13BrN2O3S — CID 9462269
N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (PubChem CID 9462269) has the molecular formula C16H13BrN2O3S and a molecular weight of 393.26 g/mol. Its IUPAC name is N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9462269 |
| Molecular Formula | C16H13BrN2O3S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)c2c(c1)OCO2)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C16H13BrN2O3S/c17-11-4-9(5-12-15(11)22-8-21-12)7-18-19-16(20)14-6-10-2-1-3-13(10)23-14/h4-7H,1-3,8H2,(H,19,20)/b18-7- |
| InChIKey | UCUIYSLCKDYSCK-WSVATBPTSA-N |
| XLogP | 3.49 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|