C15H13NO3S — CID 61055673
1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-nitrophenyl)ethanone (PubChem CID 61055673) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-nitrophenyl)ethanone.
| Compound Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 61055673 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C15H13NO3S/c17-13(15-9-11-5-3-7-14(11)20-15)8-10-4-1-2-6-12(10)16(18)19/h1-2,4,6,9H,3,5,7-8H2 |
| InChIKey | NLODKVGADDMIQO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|