C12H7Br2NO3S — CID 80536629
1-(4,5-dibromothiophen-2-yl)-2-(2-nitrophenyl)ethanone (PubChem CID 80536629) has the molecular formula C12H7Br2NO3S and a molecular weight of 405.07 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(2-nitrophenyl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 80536629 |
| Molecular Formula | C12H7Br2NO3S |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.85 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(2-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H7Br2NO3S/c13-8-6-11(19-12(8)14)10(16)5-7-3-1-2-4-9(7)15(17)18/h1-4,6H,5H2 |
| InChIKey | ACKVADKEOFCLFR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|