C16H10N4O6S — CID 4310910
N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4310910) has the molecular formula C16H10N4O6S and a molecular weight of 386.35 g/mol. Its IUPAC name is N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4310910 |
| Molecular Formula | C16H10N4O6S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1cccc([N+](=O)[O-])c1O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C16H10N4O6S/c21-15-9(2-1-3-12(15)20(25)26)8-17-18-16(22)14-7-10-6-11(19(23)24)4-5-13(10)27-14/h1-8,21H,(H,18,22) |
| InChIKey | HYILHGHZENFAKV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|