C16H9IN4O6S — CID 137155911
N-[(Z)-(2-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 137155911) has the molecular formula C16H9IN4O6S and a molecular weight of 512.24 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 137155911 |
| Molecular Formula | C16H9IN4O6S |
| Molecular Weight | 512.24 g/mol |
| Exact Mass | 511.93 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])cc(I)c1O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C16H9IN4O6S/c17-12-6-11(21(26)27)4-9(15(12)22)7-18-19-16(23)14-5-8-3-10(20(24)25)1-2-13(8)28-14/h1-7,22H,(H,19,23)/b18-7- |
| InChIKey | PBZFBGXZKLQJLU-WSVATBPTSA-N |
| XLogP | 3.79 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|