C17H15N2O6- — CID 54717649
3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenolate (PubChem CID 54717649) has the molecular formula C17H15N2O6- and a molecular weight of 343.32 g/mol. Its IUPAC name is 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenolate.
| Compound Name | 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenolate |
|---|---|
| PubChem CID | 54717649 |
| Molecular Formula | C17H15N2O6- |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-[[(Z)-(2-carboxy-3,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenolate |
| SMILES | COc1ccc(/C=N\NC(=O)c2cccc([O-])c2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C17H16N2O6/c1-24-13-7-6-11(14(17(22)23)15(13)25-2)9-18-19-16(21)10-4-3-5-12(20)8-10/h3-9,20H,1-2H3,(H,19,21)(H,22,23)/p-1/b18-9- |
| InChIKey | WWANNRKHQITBFP-NVMNQCDNSA-M |
| XLogP | 1.24 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|