C11H14FO4P — CID 11594103
4-[(E)-2-[ethoxy(fluoro)phosphoryl]ethenyl]-2-methoxyphenol (PubChem CID 11594103) has the molecular formula C11H14FO4P and a molecular weight of 260.20 g/mol. Its IUPAC name is 4-[(E)-2-[ethoxy(fluoro)phosphoryl]ethenyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-2-[ethoxy(fluoro)phosphoryl]ethenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 11594103 |
| Molecular Formula | C11H14FO4P |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[(E)-2-[ethoxy(fluoro)phosphoryl]ethenyl]-2-methoxyphenol |
| SMILES | CCOP(=O)(F)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C11H14FO4P/c1-3-16-17(12,14)7-6-9-4-5-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3/b7-6+ |
| InChIKey | OQRYVZWUEIPNDQ-VOTSOKGWSA-N |
| XLogP | 3.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|