C18H16O5 — CID 46879082
4-(3,4-dimethoxyphenyl)-7-methoxychromen-2-one (PubChem CID 46879082) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-7-methoxychromen-2-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 46879082 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(-c3ccc(OC)c(OC)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H16O5/c1-20-12-5-6-13-14(10-18(19)23-16(13)9-12)11-4-7-15(21-2)17(8-11)22-3/h4-10H,1-3H3 |
| InChIKey | AAHILKARUXRHIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|