C18H17NO5 — CID 70689704
2-amino-3-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one (PubChem CID 70689704) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-amino-3-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one.
| Compound Name | 2-amino-3-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one |
|---|---|
| PubChem CID | 70689704 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-amino-3-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one |
| SMILES | COc1ccc2c(=O)c(-c3ccc(OC)c(OC)c3)c(N)oc2c1 |
| InChI | InChI=1S/C18H17NO5/c1-21-11-5-6-12-14(9-11)24-18(19)16(17(12)20)10-4-7-13(22-2)15(8-10)23-3/h4-9H,19H2,1-3H3 |
| InChIKey | YHEKYVXUHRTZNB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |