C21H20O6S — CID 52950059
4-[[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylmethyl]-7-methoxychromen-2-one (PubChem CID 52950059) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylmethyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylmethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 52950059 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylmethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CSCC(=O)c3ccc(OC)c(OC)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H20O6S/c1-24-15-5-6-16-14(9-21(23)27-19(16)10-15)11-28-12-17(22)13-4-7-18(25-2)20(8-13)26-3/h4-10H,11-12H2,1-3H3 |
| InChIKey | SKCWOLSIBUBXEU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|