C25H20O6S — CID 19358648
O-[4-(5,6-dimethoxy-4-oxo-7-phenylmethoxychromen-2-yl)phenyl] methanethioate (PubChem CID 19358648) has the molecular formula C25H20O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is O-[4-(5,6-dimethoxy-4-oxo-7-phenylmethoxychromen-2-yl)phenyl] methanethioate.
| Compound Name | O-[4-(5,6-dimethoxy-4-oxo-7-phenylmethoxychromen-2-yl)phenyl] methanethioate |
|---|---|
| PubChem CID | 19358648 |
| Molecular Formula | C25H20O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | O-[4-(5,6-dimethoxy-4-oxo-7-phenylmethoxychromen-2-yl)phenyl] methanethioate |
| SMILES | COc1c(OCc2ccccc2)cc2oc(-c3ccc(OC=S)cc3)cc(=O)c2c1OC |
| InChI | InChI=1S/C25H20O6S/c1-27-24-22(29-14-16-6-4-3-5-7-16)13-21-23(25(24)28-2)19(26)12-20(31-21)17-8-10-18(11-9-17)30-15-32/h3-13,15H,14H2,1-2H3 |
| InChIKey | VPZZXSHUWIGOHY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|