C32H37NO6 — CID 122177812
2-[4-[6-[benzyl(methyl)amino]hexoxy]phenyl]-5,6,7-trimethoxychromen-4-one (PubChem CID 122177812) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is 2-[4-[6-[benzyl(methyl)amino]hexoxy]phenyl]-5,6,7-trimethoxychromen-4-one.
| Compound Name | 2-[4-[6-[benzyl(methyl)amino]hexoxy]phenyl]-5,6,7-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 122177812 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 2-[4-[6-[benzyl(methyl)amino]hexoxy]phenyl]-5,6,7-trimethoxychromen-4-one |
| SMILES | COc1cc2oc(-c3ccc(OCCCCCCN(C)Cc4ccccc4)cc3)cc(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C32H37NO6/c1-33(22-23-12-8-7-9-13-23)18-10-5-6-11-19-38-25-16-14-24(15-17-25)27-20-26(34)30-28(39-27)21-29(35-2)31(36-3)32(30)37-4/h7-9,12-17,20-21H,5-6,10-11,18-19,22H2,1-4H3 |
| InChIKey | DZMRMIOJIWWZHJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 70.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|