C33H39NO7 — CID 122177814
5,6,7-trimethoxy-2-[4-[6-[(2-methoxyphenyl)methyl-methylamino]hexoxy]phenyl]chromen-4-one (PubChem CID 122177814) has the molecular formula C33H39NO7 and a molecular weight of 561.68 g/mol. Its IUPAC name is 5,6,7-trimethoxy-2-[4-[6-[(2-methoxyphenyl)methyl-methylamino]hexoxy]phenyl]chromen-4-one.
| Compound Name | 5,6,7-trimethoxy-2-[4-[6-[(2-methoxyphenyl)methyl-methylamino]hexoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 122177814 |
| Molecular Formula | C33H39NO7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 5,6,7-trimethoxy-2-[4-[6-[(2-methoxyphenyl)methyl-methylamino]hexoxy]phenyl]chromen-4-one |
| SMILES | COc1ccccc1CN(C)CCCCCCOc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C33H39NO7/c1-34(22-24-12-8-9-13-27(24)36-2)18-10-6-7-11-19-40-25-16-14-23(15-17-25)28-20-26(35)31-29(41-28)21-30(37-3)32(38-4)33(31)39-5/h8-9,12-17,20-21H,6-7,10-11,18-19,22H2,1-5H3 |
| InChIKey | FJCJWXPTKNWOSL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|