C31H35NO7 — CID 122177820
2-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one (PubChem CID 122177820) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one.
| Compound Name | 2-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 122177820 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-[4-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
| SMILES | CCN(CCCCOc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1)Cc1ccccc1OC |
| InChI | InChI=1S/C31H35NO7/c1-5-32(20-22-10-6-7-11-25(22)35-2)16-8-9-17-38-23-14-12-21(13-15-23)26-18-24(33)29-27(39-26)19-28(36-3)31(37-4)30(29)34/h6-7,10-15,18-19,34H,5,8-9,16-17,20H2,1-4H3 |
| InChIKey | QBYCNPOCPXMJCE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|