C30H33NO7 — CID 122177846
2-[3-[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one (PubChem CID 122177846) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is 2-[3-[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one.
| Compound Name | 2-[3-[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 122177846 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-[3-[3-[ethyl-[(2-methoxyphenyl)methyl]amino]propoxy]phenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
| SMILES | CCN(CCCOc1cccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)c1)Cc1ccccc1OC |
| InChI | InChI=1S/C30H33NO7/c1-5-31(19-21-10-6-7-13-24(21)34-2)14-9-15-37-22-12-8-11-20(16-22)25-17-23(32)28-26(38-25)18-27(35-3)30(36-4)29(28)33/h6-8,10-13,16-18,33H,5,9,14-15,19H2,1-4H3 |
| InChIKey | ZTXCLPTZXVJBFR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|