C24H29NO4 — CID 14982977
6-[6-[2-hydroxyethyl(methyl)amino]hexoxy]-2-phenylchromen-4-one (PubChem CID 14982977) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 6-[6-[2-hydroxyethyl(methyl)amino]hexoxy]-2-phenylchromen-4-one.
| Compound Name | 6-[6-[2-hydroxyethyl(methyl)amino]hexoxy]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 14982977 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 6-[6-[2-hydroxyethyl(methyl)amino]hexoxy]-2-phenylchromen-4-one |
| SMILES | CN(CCO)CCCCCCOc1ccc2oc(-c3ccccc3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H29NO4/c1-25(14-15-26)13-7-2-3-8-16-28-20-11-12-23-21(17-20)22(27)18-24(29-23)19-9-5-4-6-10-19/h4-6,9-12,17-18,26H,2-3,7-8,13-16H2,1H3 |
| InChIKey | GIIVHFWCPKIQJN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|