C28H42N2O6 — CID 161225151
2-[2-(dimethylamino)ethoxy]ethanol;2-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]phenyl]chromen-4-one;methane (PubChem CID 161225151) has the molecular formula C28H42N2O6 and a molecular weight of 502.65 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethanol;2-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]phenyl]chromen-4-one;methane.
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethanol;2-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]phenyl]chromen-4-one;methane |
|---|---|
| PubChem CID | 161225151 |
| Molecular Formula | C28H42N2O6 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethanol;2-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]phenyl]chromen-4-one;methane |
| SMILES | C.CN(C)CCOCCO.CN(C)CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H23NO4.C6H15NO2.CH4/c1-22(2)11-12-24-13-14-25-17-9-7-16(8-10-17)21-15-19(23)18-5-3-4-6-20(18)26-21;1-7(2)3-5-9-6-4-8;/h3-10,15H,11-14H2,1-2H3;8H,3-6H2,1-2H3;1H4 |
| InChIKey | UYADEXVHMSUJCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|