C39H37NO10S — CID 54578900
N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]methanesulfonamide (PubChem CID 54578900) has the molecular formula C39H37NO10S and a molecular weight of 711.79 g/mol. Its IUPAC name is N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]methanesulfonamide.
| Compound Name | N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 54578900 |
| Molecular Formula | C39H37NO10S |
| Molecular Weight | 711.79 g/mol |
| Exact Mass | 711.21 |
| IUPAC Name | N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1)CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C39H37NO10S/c1-51(43,44)40(18-20-45-22-24-47-30-14-10-28(11-15-30)38-26-34(41)32-6-2-4-8-36(32)49-38)19-21-46-23-25-48-31-16-12-29(13-17-31)39-27-35(42)33-7-3-5-9-37(33)50-39/h2-17,26-27H,18-25H2,1H3 |
| InChIKey | GOTJTRILGOYJAZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 134.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|