C28H29ClN2O5 — CID 23645340
[3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-methylcarbamate;hydrochloride (PubChem CID 23645340) has the molecular formula C28H29ClN2O5 and a molecular weight of 509.00 g/mol. Its IUPAC name is [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-methylcarbamate;hydrochloride.
| Compound Name | [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-methylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 23645340 |
| Molecular Formula | C28H29ClN2O5 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-methylcarbamate;hydrochloride |
| SMILES | CNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)cc(-c4ccccc4)oc3c2)c1.Cl |
| InChI | InChI=1S/C28H28N2O5.ClH/c1-29-28(32)34-23-11-6-8-20(16-23)19-30(2)14-7-15-33-22-12-13-24-25(31)18-26(35-27(24)17-22)21-9-4-3-5-10-21;/h3-6,8-13,16-18H,7,14-15,19H2,1-2H3,(H,29,32);1H |
| InChIKey | XYYMLKVWPJCFMQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|