C37H47N3O6 — CID 11006704
[3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-(8-morpholin-4-yloctyl)carbamate (PubChem CID 11006704) has the molecular formula C37H47N3O6 and a molecular weight of 629.80 g/mol. Its IUPAC name is [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-(8-morpholin-4-yloctyl)carbamate.
| Compound Name | [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-(8-morpholin-4-yloctyl)carbamate |
|---|---|
| PubChem CID | 11006704 |
| Molecular Formula | C37H47N3O6 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-(8-morpholin-4-yloctyl)carbamate |
| SMILES | CN(CCCOc1ccc2c(=O)c3ccccc3oc2c1)Cc1cccc(OC(=O)NCCCCCCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C37H47N3O6/c1-39(19-11-23-44-30-16-17-33-35(27-30)46-34-15-7-6-14-32(34)36(33)41)28-29-12-10-13-31(26-29)45-37(42)38-18-8-4-2-3-5-9-20-40-21-24-43-25-22-40/h6-7,10,12-17,26-27H,2-5,8-9,11,18-25,28H2,1H3,(H,38,42) |
| InChIKey | YITSBGUNCGEFBD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|