C29H22O5 — CID 171061853
6-hydroxy-2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one (PubChem CID 171061853) has the molecular formula C29H22O5 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-hydroxy-2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one.
| Compound Name | 6-hydroxy-2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 171061853 |
| Molecular Formula | C29H22O5 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-hydroxy-2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCc3ccccc3)c(O)c(OCc3ccccc3)c12 |
| InChI | InChI=1S/C29H22O5/c30-23-16-24(22-14-8-3-9-15-22)34-25-17-26(32-18-20-10-4-1-5-11-20)28(31)29(27(23)25)33-19-21-12-6-2-7-13-21/h1-17,31H,18-19H2 |
| InChIKey | CEUAGMRUFMXAHZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |