C18H17NO5 — CID 174923932
5-(3-aminopropoxy)-6,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 174923932) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-(3-aminopropoxy)-6,7-dihydroxy-2-phenylchromen-4-one.
| Compound Name | 5-(3-aminopropoxy)-6,7-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 174923932 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-(3-aminopropoxy)-6,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | NCCCOc1c(O)c(O)cc2oc(-c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C18H17NO5/c19-7-4-8-23-18-16-12(20)9-14(11-5-2-1-3-6-11)24-15(16)10-13(21)17(18)22/h1-3,5-6,9-10,21-22H,4,7-8,19H2 |
| InChIKey | JXWMJFILVPDRNV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|