C17H15NO5 — CID 175061039
5-(ethylaminooxy)-6,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 175061039) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 5-(ethylaminooxy)-6,7-dihydroxy-2-phenylchromen-4-one.
| Compound Name | 5-(ethylaminooxy)-6,7-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 175061039 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-(ethylaminooxy)-6,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | CCNOc1c(O)c(O)cc2oc(-c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C17H15NO5/c1-2-18-23-17-15-11(19)8-13(10-6-4-3-5-7-10)22-14(15)9-12(20)16(17)21/h3-9,18,20-21H,2H2,1H3 |
| InChIKey | VSNGWKATYIUWQM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|