C30H37N3O8 — CID 175640007
[5,6-bis(diethylcarbamoyloxy)-4-oxo-2-phenylchromen-7-yl] N,N-diethylcarbamate (PubChem CID 175640007) has the molecular formula C30H37N3O8 and a molecular weight of 567.64 g/mol. Its IUPAC name is [5,6-bis(diethylcarbamoyloxy)-4-oxo-2-phenylchromen-7-yl] N,N-diethylcarbamate.
| Compound Name | [5,6-bis(diethylcarbamoyloxy)-4-oxo-2-phenylchromen-7-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 175640007 |
| Molecular Formula | C30H37N3O8 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [5,6-bis(diethylcarbamoyloxy)-4-oxo-2-phenylchromen-7-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cc2oc(-c3ccccc3)cc(=O)c2c(OC(=O)N(CC)CC)c1OC(=O)N(CC)CC |
| InChI | InChI=1S/C30H37N3O8/c1-7-31(8-2)28(35)39-24-19-23-25(21(34)18-22(38-23)20-16-14-13-15-17-20)27(41-30(37)33(11-5)12-6)26(24)40-29(36)32(9-3)10-4/h13-19H,7-12H2,1-6H3 |
| InChIKey | DIGOFSGQONPBLD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |