C44H32O7 — CID 66878364
5-hydroxy-2-phenyl-6,7-bis(phenylmethoxy)chromen-4-one;2-phenylchromen-4-one (PubChem CID 66878364) has the molecular formula C44H32O7 and a molecular weight of 672.73 g/mol. Its IUPAC name is 5-hydroxy-2-phenyl-6,7-bis(phenylmethoxy)chromen-4-one;2-phenylchromen-4-one.
| Compound Name | 5-hydroxy-2-phenyl-6,7-bis(phenylmethoxy)chromen-4-one;2-phenylchromen-4-one |
|---|---|
| PubChem CID | 66878364 |
| Molecular Formula | C44H32O7 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | 5-hydroxy-2-phenyl-6,7-bis(phenylmethoxy)chromen-4-one;2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCc3ccccc3)c(OCc3ccccc3)c(O)c12.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C29H22O5.C15H10O2/c30-23-16-24(22-14-8-3-9-15-22)34-25-17-26(32-18-20-10-4-1-5-11-20)29(28(31)27(23)25)33-19-21-12-6-2-7-13-21;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-17,31H,18-19H2;1-10H |
| InChIKey | TVDQIAJKIZIBRW-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |