C21H20O4 — CID 135026155
2,3-dimethoxy-5-(2-phenylmethoxyphenyl)phenol (PubChem CID 135026155) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(2-phenylmethoxyphenyl)phenol.
| Compound Name | 2,3-dimethoxy-5-(2-phenylmethoxyphenyl)phenol |
|---|---|
| PubChem CID | 135026155 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2,3-dimethoxy-5-(2-phenylmethoxyphenyl)phenol |
| SMILES | COc1cc(-c2ccccc2OCc2ccccc2)cc(O)c1OC |
| InChI | InChI=1S/C21H20O4/c1-23-20-13-16(12-18(22)21(20)24-2)17-10-6-7-11-19(17)25-14-15-8-4-3-5-9-15/h3-13,22H,14H2,1-2H3 |
| InChIKey | PHJCMHYVYYNACC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |