C19H18O6 — CID 155816497
7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one (PubChem CID 155816497) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one.
| Compound Name | 7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 155816497 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-2-one |
| SMILES | COc1ccc2cc(-c3cc(OC)c(OC)c(OC)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H18O6/c1-21-13-6-5-11-7-14(19(20)25-15(11)10-13)12-8-16(22-2)18(24-4)17(9-12)23-3/h5-10H,1-4H3 |
| InChIKey | HNJOSSJMCUNZPJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|