C21H20O5 — CID 1424965
3-(3,4-dimethoxyphenyl)-7-(2-methylprop-2-enoxy)chromen-2-one (PubChem CID 1424965) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-(2-methylprop-2-enoxy)chromen-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-(2-methylprop-2-enoxy)chromen-2-one |
|---|---|
| PubChem CID | 1424965 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-(2-methylprop-2-enoxy)chromen-2-one |
| SMILES | C=C(C)COc1ccc2cc(-c3ccc(OC)c(OC)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H20O5/c1-13(2)12-25-16-7-5-15-9-17(21(22)26-19(15)11-16)14-6-8-18(23-3)20(10-14)24-4/h5-11H,1,12H2,2-4H3 |
| InChIKey | BBBDBEKMCJAACQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|