C22H16O7 — CID 1383596
[3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] furan-2-carboxylate (PubChem CID 1383596) has the molecular formula C22H16O7 and a molecular weight of 392.36 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] furan-2-carboxylate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1383596 |
| Molecular Formula | C22H16O7 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] furan-2-carboxylate |
| SMILES | COc1ccc(-c2cc3ccc(OC(=O)c4ccco4)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C22H16O7/c1-25-17-8-6-13(11-20(17)26-2)16-10-14-5-7-15(12-19(14)29-21(16)23)28-22(24)18-4-3-9-27-18/h3-12H,1-2H3 |
| InChIKey | RSKUNMIEOPAQLU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|