C26H22O8 — CID 4838182
[3-(2,5-dimethoxyphenyl)-2-oxochromen-7-yl] 2,6-dimethoxybenzoate (PubChem CID 4838182) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)-2-oxochromen-7-yl] 2,6-dimethoxybenzoate.
| Compound Name | [3-(2,5-dimethoxyphenyl)-2-oxochromen-7-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 4838182 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)-2-oxochromen-7-yl] 2,6-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(-c2cc3ccc(OC(=O)c4c(OC)cccc4OC)cc3oc2=O)c1 |
| InChI | InChI=1S/C26H22O8/c1-29-16-10-11-20(30-2)18(13-16)19-12-15-8-9-17(14-23(15)34-25(19)27)33-26(28)24-21(31-3)6-5-7-22(24)32-4/h5-14H,1-4H3 |
| InChIKey | VVBKDXVCYIKFSZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|