C21H18O6 — CID 4964484
[3-(2,4-dimethoxyphenyl)-2-oxochromen-7-yl] cyclopropanecarboxylate (PubChem CID 4964484) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-2-oxochromen-7-yl] cyclopropanecarboxylate.
| Compound Name | [3-(2,4-dimethoxyphenyl)-2-oxochromen-7-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 4964484 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-2-oxochromen-7-yl] cyclopropanecarboxylate |
| SMILES | COc1ccc(-c2cc3ccc(OC(=O)C4CC4)cc3oc2=O)c(OC)c1 |
| InChI | InChI=1S/C21H18O6/c1-24-14-7-8-16(19(10-14)25-2)17-9-13-5-6-15(11-18(13)27-21(17)23)26-20(22)12-3-4-12/h5-12H,3-4H2,1-2H3 |
| InChIKey | PSULPYKCQKKQCW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|