C18H16O7S — CID 7198451
[3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] methanesulfonate (PubChem CID 7198451) has the molecular formula C18H16O7S and a molecular weight of 376.39 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] methanesulfonate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 7198451 |
| Molecular Formula | C18H16O7S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] methanesulfonate |
| SMILES | COc1ccc(-c2cc3ccc(OS(C)(=O)=O)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C18H16O7S/c1-22-15-7-5-11(9-17(15)23-2)14-8-12-4-6-13(25-26(3,20)21)10-16(12)24-18(14)19/h4-10H,1-3H3 |
| InChIKey | HPBUOANOMVZNGZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|