C21H19NO4 — CID 11703021
3-methyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[1,2-a]indol-1-one (PubChem CID 11703021) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-methyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[1,2-a]indol-1-one.
| Compound Name | 3-methyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 11703021 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-methyl-2-(3,4,5-trimethoxyphenyl)pyrrolo[1,2-a]indol-1-one |
| SMILES | COc1cc(C2=C(C)c3cc4ccccc4n3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H19NO4/c1-12-16-9-13-7-5-6-8-15(13)22(16)21(23)19(12)14-10-17(24-2)20(26-4)18(11-14)25-3/h5-11H,1-4H3 |
| InChIKey | AFQYYUGFRLEAKX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |