C38H34O8Se — CID 141321863
2-(3,4,5-trimethoxyphenyl)-1-[2-(3,4,5-trimethoxyphenyl)naphthalen-1-yl]selenonylnaphthalene (PubChem CID 141321863) has the molecular formula C38H34O8Se and a molecular weight of 697.64 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1-[2-(3,4,5-trimethoxyphenyl)naphthalen-1-yl]selenonylnaphthalene.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1-[2-(3,4,5-trimethoxyphenyl)naphthalen-1-yl]selenonylnaphthalene |
|---|---|
| PubChem CID | 141321863 |
| Molecular Formula | C38H34O8Se |
| Molecular Weight | 697.64 g/mol |
| Exact Mass | 698.14 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1-[2-(3,4,5-trimethoxyphenyl)naphthalen-1-yl]selenonylnaphthalene |
| SMILES | COc1cc(-c2ccc3ccccc3c2[Se](=O)(=O)c2c(-c3cc(OC)c(OC)c(OC)c3)ccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C38H34O8Se/c1-41-31-19-25(20-32(42-2)35(31)45-5)29-17-15-23-11-7-9-13-27(23)37(29)47(39,40)38-28-14-10-8-12-24(28)16-18-30(38)26-21-33(43-3)36(46-6)34(22-26)44-4/h7-22H,1-6H3 |
| InChIKey | RDVLQFWFCGTVJG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|