About 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene
2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene (PubChem CID 175262224) has the molecular formula C14H18OSe
and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene.
Molecular Properties
| Compound Name | 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene |
| PubChem CID | 175262224 |
| Molecular Formula | C14H18OSe |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene |
| SMILES | COc1ccc2ccccc2c1[Se](C)(C)C |
| InChI | InChI=1S/C14H18OSe/c1-15-13-10-9-11-7-5-6-8-12(11)14(13)16(2,3)4/h5-10H,1-4H3 |
| InChIKey | HRRKFCWCCCLWAZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene?
The IUPAC name of 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene (CID 175262224) is 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene.
What is the SMILES notation for 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene?
The canonical SMILES for 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene is COc1ccc2ccccc2c1[Se](C)(C)C.
What is the InChIKey of 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene?
The InChIKey is HRRKFCWCCCLWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18OSe/c1-15-13-10-9-11-7-5-6-8-12(11)14(13)16(2,3)4/h5-10H,1-4H3.
What are the key properties of 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene?
2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene has a molecular weight of 281.26 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(trimethyl-λ4-selanyl)naphthalene is sourced from PubChem (CID 175262224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).