C20H16N2O7 — CID 57171979
3-(2,1,3-benzoxadiazol-5-yl)-4-[(3,4,5-trimethoxyphenyl)methyl]furan-2,5-dione (PubChem CID 57171979) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-(2,1,3-benzoxadiazol-5-yl)-4-[(3,4,5-trimethoxyphenyl)methyl]furan-2,5-dione.
| Compound Name | 3-(2,1,3-benzoxadiazol-5-yl)-4-[(3,4,5-trimethoxyphenyl)methyl]furan-2,5-dione |
|---|---|
| PubChem CID | 57171979 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-(2,1,3-benzoxadiazol-5-yl)-4-[(3,4,5-trimethoxyphenyl)methyl]furan-2,5-dione |
| SMILES | COc1cc(CC2=C(c3ccc4nonc4c3)C(=O)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H16N2O7/c1-25-15-7-10(8-16(26-2)18(15)27-3)6-12-17(20(24)28-19(12)23)11-4-5-13-14(9-11)22-29-21-13/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | CWIWOBDLTCHWEV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|