C8H6N2O3 — CID 82410218
5-methoxy-2,1,3-benzoxadiazole-6-carbaldehyde (PubChem CID 82410218) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 5-methoxy-2,1,3-benzoxadiazole-6-carbaldehyde.
| Compound Name | 5-methoxy-2,1,3-benzoxadiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 82410218 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 5-methoxy-2,1,3-benzoxadiazole-6-carbaldehyde |
| SMILES | COc1cc2nonc2cc1C=O |
| InChI | InChI=1S/C8H6N2O3/c1-12-8-3-7-6(9-13-10-7)2-5(8)4-11/h2-4H,1H3 |
| InChIKey | YESIFUBKAPRVFJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|