C19H20N2O4 — CID 141466082
2-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline (PubChem CID 141466082) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline.
| Compound Name | 2-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline |
|---|---|
| PubChem CID | 141466082 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-methoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline |
| SMILES | COc1cc(Cc2nc3ccccc3nc2OC)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O4/c1-22-16-10-12(11-17(23-2)18(16)24-3)9-15-19(25-4)21-14-8-6-5-7-13(14)20-15/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | DKGAXKBTRGUXPL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |