C19H20N2O3S — CID 151775731
2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline-5-thiol (PubChem CID 151775731) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline-5-thiol.
| Compound Name | 2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline-5-thiol |
|---|---|
| PubChem CID | 151775731 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]quinoxaline-5-thiol |
| SMILES | COc1cc(Cc2nc3c(S)cccc3nc2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O3S/c1-11-14(21-18-13(20-11)6-5-7-17(18)25)8-12-9-15(22-2)19(24-4)16(10-12)23-3/h5-7,9-10,25H,8H2,1-4H3 |
| InChIKey | RTNQZGOQCAQAGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|